About 3-chloroaniline;2-(methylamino)ethanol
3-chloroaniline;2-(methylamino)ethanol (PubChem CID 69482377) has the molecular formula C9H15ClN2O
and a molecular weight of 202.69 g/mol. Its IUPAC name is 3-chloroaniline;2-(methylamino)ethanol.
Molecular Properties
| Compound Name | 3-chloroaniline;2-(methylamino)ethanol |
| PubChem CID | 69482377 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 3-chloroaniline;2-(methylamino)ethanol |
| SMILES | CNCCO.Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H6ClN.C3H9NO/c7-5-2-1-3-6(8)4-5;1-4-2-3-5/h1-4H,8H2;4-5H,2-3H2,1H3 |
| InChIKey | YNOTZXRAPCUKKG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloroaniline;2-(methylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroaniline;2-(methylamino)ethanol?
The IUPAC name of 3-chloroaniline;2-(methylamino)ethanol (CID 69482377) is 3-chloroaniline;2-(methylamino)ethanol.
What is the SMILES notation for 3-chloroaniline;2-(methylamino)ethanol?
The canonical SMILES for 3-chloroaniline;2-(methylamino)ethanol is CNCCO.Nc1cccc(Cl)c1.
What is the InChIKey of 3-chloroaniline;2-(methylamino)ethanol?
The InChIKey is YNOTZXRAPCUKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.C3H9NO/c7-5-2-1-3-6(8)4-5;1-4-2-3-5/h1-4H,8H2;4-5H,2-3H2,1H3.
What are the key properties of 3-chloroaniline;2-(methylamino)ethanol?
3-chloroaniline;2-(methylamino)ethanol has a molecular weight of 202.69 g/mol, XLogP of 1.12, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroaniline;2-(methylamino)ethanol is sourced from PubChem (CID 69482377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).