C17H22N2O4 — CID 69483421
2-[2-[5-(oxan-4-yloxy)-3-pyridinyl]ethenyl]pyrrolidine-1-carboxylic acid (PubChem CID 69483421) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[2-[5-(oxan-4-yloxy)-3-pyridinyl]ethenyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[2-[5-(oxan-4-yloxy)-3-pyridinyl]ethenyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69483421 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-[2-[5-(oxan-4-yloxy)-3-pyridinyl]ethenyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC1C=Cc1cncc(OC2CCOCC2)c1 |
| InChI | InChI=1S/C17H22N2O4/c20-17(21)19-7-1-2-14(19)4-3-13-10-16(12-18-11-13)23-15-5-8-22-9-6-15/h3-4,10-12,14-15H,1-2,5-9H2,(H,20,21) |
| InChIKey | XXHJDVMPHNMGDD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |