C21H30N2O4 — CID 90882027
tert-butyl (3R)-3-[2-[5-(oxan-4-yloxy)-3-pyridinyl]ethenyl]pyrrolidine-1-carboxylate (PubChem CID 90882027) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-[5-(oxan-4-yloxy)-3-pyridinyl]ethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-[5-(oxan-4-yloxy)-3-pyridinyl]ethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90882027 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | tert-butyl (3R)-3-[2-[5-(oxan-4-yloxy)-3-pyridinyl]ethenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C=Cc2cncc(OC3CCOCC3)c2)C1 |
| InChI | InChI=1S/C21H30N2O4/c1-21(2,3)27-20(24)23-9-6-16(15-23)4-5-17-12-19(14-22-13-17)26-18-7-10-25-11-8-18/h4-5,12-14,16,18H,6-11,15H2,1-3H3/t16-/m0/s1 |
| InChIKey | RWZPVSJPGSWFAH-INIZCTEOSA-N |
| XLogP | 3.91 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |