C13H16N2O3 — CID 69490166
2-ethyl-2-(2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 69490166) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-ethyl-2-(2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | 2-ethyl-2-(2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 69490166 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-ethyl-2-(2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | CCC(CC)(C(N)=O)n1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C13H16N2O3/c1-3-13(4-2,11(14)16)15-9-7-5-6-8-10(9)18-12(15)17/h5-8H,3-4H2,1-2H3,(H2,14,16) |
| InChIKey | GTKDMLUPAFPFIG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |