C20H18AlClN3O5 — CID 69492636
CID 69492636 (PubChem CID 69492636) has the molecular formula C20H18AlClN3O5 and a molecular weight of 442.82 g/mol.
| Compound Name | CID 69492636 |
|---|---|
| PubChem CID | 69492636 |
| Molecular Formula | C20H18AlClN3O5 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | — |
| SMILES | COc1cc(C2=C(c3c[nH]c4ncccc34)C(=O)NC2=O)cc(OC)c1OC.Cl.[Al] |
| InChI | InChI=1S/C20H17N3O5.Al.ClH/c1-26-13-7-10(8-14(27-2)17(13)28-3)15-16(20(25)23-19(15)24)12-9-22-18-11(12)5-4-6-21-18;;/h4-9H,1-3H3,(H,21,22)(H,23,24,25);;1H |
| InChIKey | SKIULQUADAGQIZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|