About pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine
pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine (PubChem CID 69498944) has the molecular formula C15H21N2O3P
and a molecular weight of 308.32 g/mol. Its IUPAC name is pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine |
| PubChem CID | 69498944 |
| Molecular Formula | C15H21N2O3P |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine |
| SMILES | CCC(CC)P(=O)(O)O.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.C5H13O3P/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;1-3-5(4-2)9(6,7)8/h1-8H;5H,3-4H2,1-2H3,(H2,6,7,8) |
| InChIKey | HJULNTMDNDDAJD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine?
The IUPAC name of pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine (CID 69498944) is pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine.
What is the SMILES notation for pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine?
The canonical SMILES for pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine is CCC(CC)P(=O)(O)O.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine?
The InChIKey is HJULNTMDNDDAJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C5H13O3P/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;1-3-5(4-2)9(6,7)8/h1-8H;5H,3-4H2,1-2H3,(H2,6,7,8).
What are the key properties of pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine?
pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine has a molecular weight of 308.32 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-ylphosphonic acid;2-pyridin-2-ylpyridine is sourced from PubChem (CID 69498944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).