C16H17ClN3O2S- — CID 6969999
2-[[4-(3-chlorophenyl)-5-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 6969999) has the molecular formula C16H17ClN3O2S- and a molecular weight of 350.85 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)-5-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-[[4-(3-chlorophenyl)-5-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 6969999 |
| Molecular Formula | C16H17ClN3O2S- |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)-5-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | O=C([O-])CSc1nnc(C2CCCCC2)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18ClN3O2S/c17-12-7-4-8-13(9-12)20-15(11-5-2-1-3-6-11)18-19-16(20)23-10-14(21)22/h4,7-9,11H,1-3,5-6,10H2,(H,21,22)/p-1 |
| InChIKey | AHNGNPDKILGZOB-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |