C17H18FN4O2S- — CID 7831325
2-[[5-cyclohexyl-4-[(Z)-(3-fluorophenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 7831325) has the molecular formula C17H18FN4O2S- and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[[5-cyclohexyl-4-[(Z)-(3-fluorophenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-[[5-cyclohexyl-4-[(Z)-(3-fluorophenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 7831325 |
| Molecular Formula | C17H18FN4O2S- |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[[5-cyclohexyl-4-[(Z)-(3-fluorophenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | O=C([O-])CSc1nnc(C2CCCCC2)n1/N=C\c1cccc(F)c1 |
| InChI | InChI=1S/C17H19FN4O2S/c18-14-8-4-5-12(9-14)10-19-22-16(13-6-2-1-3-7-13)20-21-17(22)25-11-15(23)24/h4-5,8-10,13H,1-3,6-7,11H2,(H,23,24)/p-1/b19-10- |
| InChIKey | CDZARDFPXRMCCW-GRSHGNNSSA-M |
| XLogP | 2.19 |
| TPSA | 83.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|