C19H23N4O4S- — CID 9240155
2-[[5-cyclohexyl-4-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 9240155) has the molecular formula C19H23N4O4S- and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[[5-cyclohexyl-4-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-[[5-cyclohexyl-4-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 9240155 |
| Molecular Formula | C19H23N4O4S- |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-[[5-cyclohexyl-4-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | COc1ccc(/C=N\n2c(SCC(=O)[O-])nnc2C2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C19H24N4O4S/c1-26-15-9-8-14(16(10-15)27-2)11-20-23-18(13-6-4-3-5-7-13)21-22-19(23)28-12-17(24)25/h8-11,13H,3-7,12H2,1-2H3,(H,24,25)/p-1/b20-11- |
| InChIKey | LYCGKNMOXLFRIX-JAIQZWGSSA-M |
| XLogP | 2.07 |
| TPSA | 101.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|