C17H18ClN4O3S- — CID 135557650
2-[[4-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-5-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 135557650) has the molecular formula C17H18ClN4O3S- and a molecular weight of 393.88 g/mol. Its IUPAC name is 2-[[4-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-5-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-[[4-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-5-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 135557650 |
| Molecular Formula | C17H18ClN4O3S- |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-[[4-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-5-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | O=C([O-])CSc1nnc(C2CCCCC2)n1/N=C/c1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H19ClN4O3S/c18-13-6-7-14(23)12(8-13)9-19-22-16(11-4-2-1-3-5-11)20-21-17(22)26-10-15(24)25/h6-9,11,23H,1-5,10H2,(H,24,25)/p-1/b19-9+ |
| InChIKey | KXFADODOLDXROU-DJKKODMXSA-M |
| XLogP | 2.41 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|