C21H21N4O2S- — CID 9240645
2-[[5-cyclohexyl-4-[(Z)-naphthalen-2-ylmethylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 9240645) has the molecular formula C21H21N4O2S- and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[[5-cyclohexyl-4-[(Z)-naphthalen-2-ylmethylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-[[5-cyclohexyl-4-[(Z)-naphthalen-2-ylmethylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 9240645 |
| Molecular Formula | C21H21N4O2S- |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-[[5-cyclohexyl-4-[(Z)-naphthalen-2-ylmethylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | O=C([O-])CSc1nnc(C2CCCCC2)n1/N=C\c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H22N4O2S/c26-19(27)14-28-21-24-23-20(17-7-2-1-3-8-17)25(21)22-13-15-10-11-16-6-4-5-9-18(16)12-15/h4-6,9-13,17H,1-3,7-8,14H2,(H,26,27)/p-1/b22-13- |
| InChIKey | VWTJZNNUFCNCJD-XKZIYDEJSA-M |
| XLogP | 3.20 |
| TPSA | 83.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|