C18H22N4O2S — CID 9240555
2-[[5-cyclohexyl-4-[(Z)-(3-methylphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 9240555) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-[[5-cyclohexyl-4-[(Z)-(3-methylphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-cyclohexyl-4-[(Z)-(3-methylphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 9240555 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-[[5-cyclohexyl-4-[(Z)-(3-methylphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Cc1cccc(/C=N\n2c(SCC(=O)O)nnc2C2CCCCC2)c1 |
| InChI | InChI=1S/C18H22N4O2S/c1-13-6-5-7-14(10-13)11-19-22-17(15-8-3-2-4-9-15)20-21-18(22)25-12-16(23)24/h5-7,10-11,15H,2-4,8-9,12H2,1H3,(H,23,24)/b19-11- |
| InChIKey | JRDAEHHSHNQGGZ-ODLFYWEKSA-N |
| XLogP | 3.69 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|