C9H18NO3S+ — CID 6982121
(3S,4S)-1,1-dioxo-4-piperidin-1-ium-1-ylthiolan-3-ol (PubChem CID 6982121) has the molecular formula C9H18NO3S+ and a molecular weight of 220.31 g/mol. Its IUPAC name is (3S,4S)-1,1-dioxo-4-piperidin-1-ium-1-ylthiolan-3-ol.
| Compound Name | (3S,4S)-1,1-dioxo-4-piperidin-1-ium-1-ylthiolan-3-ol |
|---|---|
| PubChem CID | 6982121 |
| Molecular Formula | C9H18NO3S+ |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | (3S,4S)-1,1-dioxo-4-piperidin-1-ium-1-ylthiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H]([NH+]2CCCCC2)C1 |
| InChI | InChI=1S/C9H17NO3S/c11-9-7-14(12,13)6-8(9)10-4-2-1-3-5-10/h8-9,11H,1-7H2/p+1/t8-,9-/m1/s1 |
| InChIKey | SNEPMRMWHXCLPC-RKDXNWHRSA-O |
| XLogP | -1.79 |
| TPSA | 58.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |