C18H15N3O3S — CID 6985446
7,7-dimethyl-4-(4-nitrophenyl)-5-oxo-2-sulfanylidene-6,8-dihydro-4aH-quinoline-3-carbonitrile (PubChem CID 6985446) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 7,7-dimethyl-4-(4-nitrophenyl)-5-oxo-2-sulfanylidene-6,8-dihydro-4aH-quinoline-3-carbonitrile.
| Compound Name | 7,7-dimethyl-4-(4-nitrophenyl)-5-oxo-2-sulfanylidene-6,8-dihydro-4aH-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 6985446 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 7,7-dimethyl-4-(4-nitrophenyl)-5-oxo-2-sulfanylidene-6,8-dihydro-4aH-quinoline-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2C(=NC(=S)C(C#N)=C2c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H15N3O3S/c1-18(2)7-13-16(14(22)8-18)15(12(9-19)17(25)20-13)10-3-5-11(6-4-10)21(23)24/h3-6,16H,7-8H2,1-2H3 |
| InChIKey | SGNNWWVZDGPQLN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|