C14H18N3O3+ — CID 6986271
2-(2,4-dimethoxyanilino)-1-prop-2-enyl-4H-imidazol-3-ium-5-one (PubChem CID 6986271) has the molecular formula C14H18N3O3+ and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-(2,4-dimethoxyanilino)-1-prop-2-enyl-4H-imidazol-3-ium-5-one.
| Compound Name | 2-(2,4-dimethoxyanilino)-1-prop-2-enyl-4H-imidazol-3-ium-5-one |
|---|---|
| PubChem CID | 6986271 |
| Molecular Formula | C14H18N3O3+ |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(2,4-dimethoxyanilino)-1-prop-2-enyl-4H-imidazol-3-ium-5-one |
| SMILES | C=CCN1C(=O)C[NH+]=C1Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H17N3O3/c1-4-7-17-13(18)9-15-14(17)16-11-6-5-10(19-2)8-12(11)20-3/h4-6,8H,1,7,9H2,2-3H3,(H,15,16)/p+1 |
| InChIKey | VSFJQBHIIYBOIH-UHFFFAOYSA-O |
| XLogP | -0.42 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|