C15H14N3O2+ — CID 6991741
2-[(2-amino-5-methylpyridin-1-ium-1-yl)methyl]isoindole-1,3-dione (PubChem CID 6991741) has the molecular formula C15H14N3O2+ and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-[(2-amino-5-methylpyridin-1-ium-1-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(2-amino-5-methylpyridin-1-ium-1-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6991741 |
| Molecular Formula | C15H14N3O2+ |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[(2-amino-5-methylpyridin-1-ium-1-yl)methyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(N)[n+](CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C15H13N3O2/c1-10-6-7-13(16)17(8-10)9-18-14(19)11-4-2-3-5-12(11)15(18)20/h2-8,16H,9H2,1H3/p+1 |
| InChIKey | RFXXRNJSDZXQEF-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 67.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|