C14H12NO4- — CID 6994910
3-[(4E)-4-benzylidene-2,3-dioxopyrrolidin-1-yl]propanoate (PubChem CID 6994910) has the molecular formula C14H12NO4- and a molecular weight of 258.25 g/mol. Its IUPAC name is 3-[(4E)-4-benzylidene-2,3-dioxopyrrolidin-1-yl]propanoate.
| Compound Name | 3-[(4E)-4-benzylidene-2,3-dioxopyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 6994910 |
| Molecular Formula | C14H12NO4- |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-[(4E)-4-benzylidene-2,3-dioxopyrrolidin-1-yl]propanoate |
| SMILES | O=C([O-])CCN1C/C(=C\c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C14H13NO4/c16-12(17)6-7-15-9-11(13(18)14(15)19)8-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2,(H,16,17)/p-1/b11-8+ |
| InChIKey | XKWFVQIWIXUCSQ-DHZHZOJOSA-M |
| XLogP | -0.38 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|