C8H13N4O2+ — CID 6995469
(4R,5R)-1,3,7-trimethyl-5,9-dihydro-4H-purin-7-ium-2,6-dione (PubChem CID 6995469) has the molecular formula C8H13N4O2+ and a molecular weight of 197.22 g/mol. Its IUPAC name is (4R,5R)-1,3,7-trimethyl-5,9-dihydro-4H-purin-7-ium-2,6-dione.
| Compound Name | (4R,5R)-1,3,7-trimethyl-5,9-dihydro-4H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 6995469 |
| Molecular Formula | C8H13N4O2+ |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (4R,5R)-1,3,7-trimethyl-5,9-dihydro-4H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)[C@H]2[C@H](NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C8H12N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4-6H,1-3H3/p+1/t5-,6-/m1/s1 |
| InChIKey | PKROKIUCEJBAQW-PHDIDXHHSA-O |
| XLogP | -1.52 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|