C31H24N2O8S — CID 6997446
[3-(4-nitrophenyl)-4-oxochromen-7-yl] (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 6997446) has the molecular formula C31H24N2O8S and a molecular weight of 584.61 g/mol. Its IUPAC name is [3-(4-nitrophenyl)-4-oxochromen-7-yl] (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | [3-(4-nitrophenyl)-4-oxochromen-7-yl] (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6997446 |
| Molecular Formula | C31H24N2O8S |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | [3-(4-nitrophenyl)-4-oxochromen-7-yl] (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)Oc2ccc3c(=O)c(-c4ccc([N+](=O)[O-])cc4)coc3c2)cc1 |
| InChI | InChI=1S/C31H24N2O8S/c1-20-7-14-25(15-8-20)42(38,39)32-28(17-21-5-3-2-4-6-21)31(35)41-24-13-16-26-29(18-24)40-19-27(30(26)34)22-9-11-23(12-10-22)33(36)37/h2-16,18-19,28,32H,17H2,1H3/t28-/m0/s1 |
| InChIKey | DUNBENAMVLCURP-NDEPHWFRSA-N |
| XLogP | 5.17 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|