C24H37N3O6 — CID 70001773
tert-butyl N-[1-[(1-hydroxy-2-oxo-5-phenylpentan-3-yl)amino]-3-(2-methylbutylamino)-1,3-dioxopropan-2-yl]carbamate (PubChem CID 70001773) has the molecular formula C24H37N3O6 and a molecular weight of 463.58 g/mol. Its IUPAC name is tert-butyl N-[1-[(1-hydroxy-2-oxo-5-phenylpentan-3-yl)amino]-3-(2-methylbutylamino)-1,3-dioxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(1-hydroxy-2-oxo-5-phenylpentan-3-yl)amino]-3-(2-methylbutylamino)-1,3-dioxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70001773 |
| Molecular Formula | C24H37N3O6 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | tert-butyl N-[1-[(1-hydroxy-2-oxo-5-phenylpentan-3-yl)amino]-3-(2-methylbutylamino)-1,3-dioxopropan-2-yl]carbamate |
| SMILES | CCC(C)CNC(=O)C(NC(=O)OC(C)(C)C)C(=O)NC(CCc1ccccc1)C(=O)CO |
| InChI | InChI=1S/C24H37N3O6/c1-6-16(2)14-25-21(30)20(27-23(32)33-24(3,4)5)22(31)26-18(19(29)15-28)13-12-17-10-8-7-9-11-17/h7-11,16,18,20,28H,6,12-15H2,1-5H3,(H,25,30)(H,26,31)(H,27,32) |
| InChIKey | VBERSLGXEAHZDB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|