C18H19N4O2S+ — CID 7000265
[(5R)-4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-yl]methylidene-[2-(1H-indol-3-yl)ethyl]azanium (PubChem CID 7000265) has the molecular formula C18H19N4O2S+ and a molecular weight of 355.44 g/mol. Its IUPAC name is [(5R)-4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-yl]methylidene-[2-(1H-indol-3-yl)ethyl]azanium.
| Compound Name | [(5R)-4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-yl]methylidene-[2-(1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 7000265 |
| Molecular Formula | C18H19N4O2S+ |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [(5R)-4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-yl]methylidene-[2-(1H-indol-3-yl)ethyl]azanium |
| SMILES | C=CCN1C(=O)[C@H](/C=[NH+]/CCc2c[nH]c3ccccc23)C(=O)NC1=S |
| InChI | InChI=1S/C18H18N4O2S/c1-2-9-22-17(24)14(16(23)21-18(22)25)11-19-8-7-12-10-20-15-6-4-3-5-13(12)15/h2-6,10-11,14,20H,1,7-9H2,(H,21,23,25)/p+1/b19-11+/t14-/m1/s1 |
| InChIKey | FGUMAQUZPLAGRN-HIPSJFSSSA-O |
| XLogP | -0.09 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|