C33H36O6 — CID 70018857
1-[3-methyl-7-(3-methylbut-2-enoxy)-2-phenyl-3,4-dihydro-2H-chromen-8-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 70018857) has the molecular formula C33H36O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is 1-[3-methyl-7-(3-methylbut-2-enoxy)-2-phenyl-3,4-dihydro-2H-chromen-8-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[3-methyl-7-(3-methylbut-2-enoxy)-2-phenyl-3,4-dihydro-2H-chromen-8-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70018857 |
| Molecular Formula | C33H36O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 1-[3-methyl-7-(3-methylbut-2-enoxy)-2-phenyl-3,4-dihydro-2H-chromen-8-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2c(OCC=C(C)C)ccc3c2OC(c2ccccc2)C(C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C33H36O6/c1-21(2)16-17-38-27-15-13-25-18-22(3)31(24-10-8-7-9-11-24)39-32(25)30(27)26(34)14-12-23-19-28(35-4)33(37-6)29(20-23)36-5/h7-16,19-20,22,31H,17-18H2,1-6H3 |
| InChIKey | GXWHBVIPXUEEMB-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|