C23H43NO3 — CID 70019034
(11Z,14Z)-4-(2-aminooxetan-2-yl)icosa-11,14-diene-3,3-diol (PubChem CID 70019034) has the molecular formula C23H43NO3 and a molecular weight of 381.60 g/mol. Its IUPAC name is (11Z,14Z)-4-(2-aminooxetan-2-yl)icosa-11,14-diene-3,3-diol.
| Compound Name | (11Z,14Z)-4-(2-aminooxetan-2-yl)icosa-11,14-diene-3,3-diol |
|---|---|
| PubChem CID | 70019034 |
| Molecular Formula | C23H43NO3 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.32 |
| IUPAC Name | (11Z,14Z)-4-(2-aminooxetan-2-yl)icosa-11,14-diene-3,3-diol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(C(O)(O)CC)C1(N)CCO1 |
| InChI | InChI=1S/C23H43NO3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23(25,26)4-2)22(24)19-20-27-22/h8-9,11-12,21,25-26H,3-7,10,13-20,24H2,1-2H3/b9-8-,12-11- |
| InChIKey | VILAEVMMRDMWOZ-MURFETPASA-N |
| XLogP | 5.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|