C23H24N2O4S2 — CID 70024183
(6R,8S)-8-methyl-9-oxo-N-[4-(1,3-thiazolidin-3-ylmethyl)phenyl]-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide (PubChem CID 70024183) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is (6R,8S)-8-methyl-9-oxo-N-[4-(1,3-thiazolidin-3-ylmethyl)phenyl]-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide.
| Compound Name | (6R,8S)-8-methyl-9-oxo-N-[4-(1,3-thiazolidin-3-ylmethyl)phenyl]-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide |
|---|---|
| PubChem CID | 70024183 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (6R,8S)-8-methyl-9-oxo-N-[4-(1,3-thiazolidin-3-ylmethyl)phenyl]-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide |
| SMILES | C[C@@H]1S[C@@H](C(=O)Nc2ccc(CN3CCSC3)cc2)Cc2cc3c(cc2C1=O)OCO3 |
| InChI | InChI=1S/C23H24N2O4S2/c1-14-22(26)18-10-20-19(28-13-29-20)8-16(18)9-21(31-14)23(27)24-17-4-2-15(3-5-17)11-25-6-7-30-12-25/h2-5,8,10,14,21H,6-7,9,11-13H2,1H3,(H,24,27)/t14-,21+/m0/s1 |
| InChIKey | STOOCXRFWYDIPS-LHSJRXKWSA-N |
| XLogP | 3.79 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |