C24H28NO7PS — CID 90868549
(6R,8S)-N-[4-(diethoxyphosphorylmethyl)phenyl]-8-methyl-5-oxo-8,9-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide (PubChem CID 90868549) has the molecular formula C24H28NO7PS and a molecular weight of 505.53 g/mol. Its IUPAC name is (6R,8S)-N-[4-(diethoxyphosphorylmethyl)phenyl]-8-methyl-5-oxo-8,9-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide.
| Compound Name | (6R,8S)-N-[4-(diethoxyphosphorylmethyl)phenyl]-8-methyl-5-oxo-8,9-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide |
|---|---|
| PubChem CID | 90868549 |
| Molecular Formula | C24H28NO7PS |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | (6R,8S)-N-[4-(diethoxyphosphorylmethyl)phenyl]-8-methyl-5-oxo-8,9-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)[C@@H]2S[C@@H](C)Cc3cc4c(cc3C2=O)OCO4)cc1)OCC |
| InChI | InChI=1S/C24H28NO7PS/c1-4-31-33(28,32-5-2)13-16-6-8-18(9-7-16)25-24(27)23-22(26)19-12-21-20(29-14-30-21)11-17(19)10-15(3)34-23/h6-9,11-12,15,23H,4-5,10,13-14H2,1-3H3,(H,25,27)/t15-,23+/m0/s1 |
| InChIKey | JJOBPGZASFAYJZ-NPMXOYFQSA-N |
| XLogP | 5.05 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|