C15H22NO7P — CID 11810489
ethyl 2-(1,3-benzodioxol-5-ylamino)-2-diethoxyphosphorylacetate (PubChem CID 11810489) has the molecular formula C15H22NO7P and a molecular weight of 359.32 g/mol. Its IUPAC name is ethyl 2-(1,3-benzodioxol-5-ylamino)-2-diethoxyphosphorylacetate.
| Compound Name | ethyl 2-(1,3-benzodioxol-5-ylamino)-2-diethoxyphosphorylacetate |
|---|---|
| PubChem CID | 11810489 |
| Molecular Formula | C15H22NO7P |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | ethyl 2-(1,3-benzodioxol-5-ylamino)-2-diethoxyphosphorylacetate |
| SMILES | CCOC(=O)C(Nc1ccc2c(c1)OCO2)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H22NO7P/c1-4-19-15(17)14(24(18,22-5-2)23-6-3)16-11-7-8-12-13(9-11)21-10-20-12/h7-9,14,16H,4-6,10H2,1-3H3 |
| InChIKey | YCCDEWUJKIHAJQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|