C16H23NO6 — CID 70026671
3-(3,4,5-trimethoxyphenoxy)propyl (Z)-3-aminobut-2-enoate (PubChem CID 70026671) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenoxy)propyl (Z)-3-aminobut-2-enoate.
| Compound Name | 3-(3,4,5-trimethoxyphenoxy)propyl (Z)-3-aminobut-2-enoate |
|---|---|
| PubChem CID | 70026671 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenoxy)propyl (Z)-3-aminobut-2-enoate |
| SMILES | COc1cc(OCCCOC(=O)/C=C(/C)N)cc(OC)c1OC |
| InChI | InChI=1S/C16H23NO6/c1-11(17)8-15(18)23-7-5-6-22-12-9-13(19-2)16(21-4)14(10-12)20-3/h8-10H,5-7,17H2,1-4H3/b11-8- |
| InChIKey | NOMOCNULMWGARO-FLIBITNWSA-N |
| XLogP | 1.89 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|