C11H13BrO5 — CID 22573940
2-(3,4,5-trimethoxyphenoxy)acetyl bromide (PubChem CID 22573940) has the molecular formula C11H13BrO5 and a molecular weight of 305.12 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenoxy)acetyl bromide.
| Compound Name | 2-(3,4,5-trimethoxyphenoxy)acetyl bromide |
|---|---|
| PubChem CID | 22573940 |
| Molecular Formula | C11H13BrO5 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenoxy)acetyl bromide |
| SMILES | COc1cc(OCC(=O)Br)cc(OC)c1OC |
| InChI | InChI=1S/C11H13BrO5/c1-14-8-4-7(17-6-10(12)13)5-9(15-2)11(8)16-3/h4-5H,6H2,1-3H3 |
| InChIKey | KWVKCUNBODCVRE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|