C27H33N3O2 — CID 70033843
tert-butyl 4-[4-(1-cyano-4-phenylcyclohexa-2,4-dien-1-yl)but-3-ynyl]-1,4-diazepane-1-carboxylate (PubChem CID 70033843) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is tert-butyl 4-[4-(1-cyano-4-phenylcyclohexa-2,4-dien-1-yl)but-3-ynyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(1-cyano-4-phenylcyclohexa-2,4-dien-1-yl)but-3-ynyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 70033843 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | tert-butyl 4-[4-(1-cyano-4-phenylcyclohexa-2,4-dien-1-yl)but-3-ynyl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(CCC#CC2(C#N)C=CC(c3ccccc3)=CC2)CC1 |
| InChI | InChI=1S/C27H33N3O2/c1-26(2,3)32-25(31)30-19-9-18-29(20-21-30)17-8-7-14-27(22-28)15-12-24(13-16-27)23-10-5-4-6-11-23/h4-6,10-13,15H,8-9,16-21H2,1-3H3 |
| InChIKey | COCDUNSYBWMNGH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|