C20H37N4O5P — CID 70040105
(2S)-1-[(2S)-1-[(2S)-6-amino-2-(diethylphosphorylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 70040105) has the molecular formula C20H37N4O5P and a molecular weight of 444.51 g/mol. Its IUPAC name is (2S)-1-[(2S)-1-[(2S)-6-amino-2-(diethylphosphorylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-1-[(2S)-6-amino-2-(diethylphosphorylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70040105 |
| Molecular Formula | C20H37N4O5P |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (2S)-1-[(2S)-1-[(2S)-6-amino-2-(diethylphosphorylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCP(=O)(CC)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C20H37N4O5P/c1-3-30(29,4-2)22-15(9-5-6-12-21)18(25)23-13-7-10-16(23)19(26)24-14-8-11-17(24)20(27)28/h15-17H,3-14,21H2,1-2H3,(H,22,29)(H,27,28)/t15-,16-,17-/m0/s1 |
| InChIKey | LJXSFASNARNQGQ-ULQDDVLXSA-N |
| XLogP | 1.46 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|