C32H53N4O6PS — CID 70041771
(2S)-2-[[(2S)-2-(dibutoxyphosphorylamino)-3-phenylpropanoyl]amino]-N-[(1R,2S)-1-hydroxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-methylpentanamide (PubChem CID 70041771) has the molecular formula C32H53N4O6PS and a molecular weight of 652.84 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(dibutoxyphosphorylamino)-3-phenylpropanoyl]amino]-N-[(1R,2S)-1-hydroxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-2-(dibutoxyphosphorylamino)-3-phenylpropanoyl]amino]-N-[(1R,2S)-1-hydroxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 70041771 |
| Molecular Formula | C32H53N4O6PS |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | (2S)-2-[[(2S)-2-(dibutoxyphosphorylamino)-3-phenylpropanoyl]amino]-N-[(1R,2S)-1-hydroxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-methylpentanamide |
| SMILES | CCCCOP(=O)(N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)[C@@H](O)c1nccs1)OCCCC |
| InChI | InChI=1S/C32H53N4O6PS/c1-7-9-17-41-43(40,42-18-10-8-2)36-28(22-25-14-12-11-13-15-25)31(39)35-27(21-24(5)6)30(38)34-26(20-23(3)4)29(37)32-33-16-19-44-32/h11-16,19,23-24,26-29,37H,7-10,17-18,20-22H2,1-6H3,(H,34,38)(H,35,39)(H,36,40)/t26-,27-,28-,29+/m0/s1 |
| InChIKey | WSOAPBNYTDBHFP-XFTNXAEASA-N |
| XLogP | 6.18 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|