C16H11F5N2O6 — CID 70042936
2-(fluoromethyl)-4-[6-fluoro-3-nitro-2-(trifluoromethyl)phenyl]-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 70042936) has the molecular formula C16H11F5N2O6 and a molecular weight of 422.26 g/mol. Its IUPAC name is 2-(fluoromethyl)-4-[6-fluoro-3-nitro-2-(trifluoromethyl)phenyl]-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 2-(fluoromethyl)-4-[6-fluoro-3-nitro-2-(trifluoromethyl)phenyl]-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70042936 |
| Molecular Formula | C16H11F5N2O6 |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 2-(fluoromethyl)-4-[6-fluoro-3-nitro-2-(trifluoromethyl)phenyl]-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2c(F)ccc([N+](=O)[O-])c2C(F)(F)F)C(C(=O)O)=C(CF)N1 |
| InChI | InChI=1S/C16H11F5N2O6/c1-5-9(14(24)25)12(11(15(26)27)7(4-17)22-5)10-6(18)2-3-8(23(28)29)13(10)16(19,20)21/h2-3,12,22H,4H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | GPEQQFLNNOASKC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|