C28H41N3O2 — CID 70049543
(2R)-1-(6-cyano-7-methyl-6-phenyloctanoyl)-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide (PubChem CID 70049543) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is (2R)-1-(6-cyano-7-methyl-6-phenyloctanoyl)-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(6-cyano-7-methyl-6-phenyloctanoyl)-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70049543 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | (2R)-1-(6-cyano-7-methyl-6-phenyloctanoyl)-N-(4-methylcyclohexyl)pyrrolidine-2-carboxamide |
| SMILES | CC1CCC(NC(=O)[C@H]2CCCN2C(=O)CCCCC(C#N)(c2ccccc2)C(C)C)CC1 |
| InChI | InChI=1S/C28H41N3O2/c1-21(2)28(20-29,23-10-5-4-6-11-23)18-8-7-13-26(32)31-19-9-12-25(31)27(33)30-24-16-14-22(3)15-17-24/h4-6,10-11,21-22,24-25H,7-9,12-19H2,1-3H3,(H,30,33)/t22?,24?,25-,28?/m1/s1 |
| InChIKey | CEALPZFIUKSLGP-CGRAWJLISA-N |
| XLogP | 5.35 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|