C28H34ClN3O2 — CID 70053809
(2R)-N-[(3-chlorophenyl)methyl]-1-[(6S)-6-cyano-7-methyl-6-phenyloctanoyl]pyrrolidine-2-carboxamide (PubChem CID 70053809) has the molecular formula C28H34ClN3O2 and a molecular weight of 480.05 g/mol. Its IUPAC name is (2R)-N-[(3-chlorophenyl)methyl]-1-[(6S)-6-cyano-7-methyl-6-phenyloctanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(3-chlorophenyl)methyl]-1-[(6S)-6-cyano-7-methyl-6-phenyloctanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70053809 |
| Molecular Formula | C28H34ClN3O2 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | (2R)-N-[(3-chlorophenyl)methyl]-1-[(6S)-6-cyano-7-methyl-6-phenyloctanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@@](C#N)(CCCCC(=O)N1CCC[C@@H]1C(=O)NCc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C28H34ClN3O2/c1-21(2)28(20-30,23-11-4-3-5-12-23)16-7-6-15-26(33)32-17-9-14-25(32)27(34)31-19-22-10-8-13-24(29)18-22/h3-5,8,10-13,18,21,25H,6-7,9,14-17,19H2,1-2H3,(H,31,34)/t25-,28+/m1/s1 |
| InChIKey | KXXVUABJEIHAHA-NAKRPHOHSA-N |
| XLogP | 5.63 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|