C28H33ClFN3O2 — CID 70049908
(2R)-N-[(2-chloro-6-fluorophenyl)methyl]-1-[(6S)-6-cyano-7-methyl-6-phenyloctanoyl]pyrrolidine-2-carboxamide (PubChem CID 70049908) has the molecular formula C28H33ClFN3O2 and a molecular weight of 498.04 g/mol. Its IUPAC name is (2R)-N-[(2-chloro-6-fluorophenyl)methyl]-1-[(6S)-6-cyano-7-methyl-6-phenyloctanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(2-chloro-6-fluorophenyl)methyl]-1-[(6S)-6-cyano-7-methyl-6-phenyloctanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70049908 |
| Molecular Formula | C28H33ClFN3O2 |
| Molecular Weight | 498.04 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (2R)-N-[(2-chloro-6-fluorophenyl)methyl]-1-[(6S)-6-cyano-7-methyl-6-phenyloctanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@@](C#N)(CCCCC(=O)N1CCC[C@@H]1C(=O)NCc1c(F)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C28H33ClFN3O2/c1-20(2)28(19-31,21-10-4-3-5-11-21)16-7-6-15-26(34)33-17-9-14-25(33)27(35)32-18-22-23(29)12-8-13-24(22)30/h3-5,8,10-13,20,25H,6-7,9,14-18H2,1-2H3,(H,32,35)/t25-,28+/m1/s1 |
| InChIKey | LUDDMIKDZIHLTK-NAKRPHOHSA-N |
| XLogP | 5.76 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.04 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|