C31H41N3O2 — CID 70051243
(2R)-1-(6-cyano-7-methyl-6-phenyloctanoyl)-N-(4-phenylbutan-2-yl)pyrrolidine-2-carboxamide (PubChem CID 70051243) has the molecular formula C31H41N3O2 and a molecular weight of 487.69 g/mol. Its IUPAC name is (2R)-1-(6-cyano-7-methyl-6-phenyloctanoyl)-N-(4-phenylbutan-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(6-cyano-7-methyl-6-phenyloctanoyl)-N-(4-phenylbutan-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70051243 |
| Molecular Formula | C31H41N3O2 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | (2R)-1-(6-cyano-7-methyl-6-phenyloctanoyl)-N-(4-phenylbutan-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)[C@H]1CCCN1C(=O)CCCCC(C#N)(c1ccccc1)C(C)C |
| InChI | InChI=1S/C31H41N3O2/c1-24(2)31(23-32,27-15-8-5-9-16-27)21-11-10-18-29(35)34-22-12-17-28(34)30(36)33-25(3)19-20-26-13-6-4-7-14-26/h4-9,13-16,24-25,28H,10-12,17-22H2,1-3H3,(H,33,36)/t25?,28-,31?/m1/s1 |
| InChIKey | SWILDDGJNAYBKC-DPPLCSQNSA-N |
| XLogP | 5.79 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|