C32H37N3O4S2 — CID 70053414
(2R)-N-benzhydryl-1-(6-cyano-7-methyl-6-thiophen-2-ylsulfonyloctanoyl)pyrrolidine-2-carboxamide (PubChem CID 70053414) has the molecular formula C32H37N3O4S2 and a molecular weight of 591.80 g/mol. Its IUPAC name is (2R)-N-benzhydryl-1-(6-cyano-7-methyl-6-thiophen-2-ylsulfonyloctanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-benzhydryl-1-(6-cyano-7-methyl-6-thiophen-2-ylsulfonyloctanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70053414 |
| Molecular Formula | C32H37N3O4S2 |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | (2R)-N-benzhydryl-1-(6-cyano-7-methyl-6-thiophen-2-ylsulfonyloctanoyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(C#N)(CCCCC(=O)N1CCC[C@@H]1C(=O)NC(c1ccccc1)c1ccccc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C32H37N3O4S2/c1-24(2)32(23-33,41(38,39)29-19-12-22-40-29)20-10-9-18-28(36)35-21-11-17-27(35)31(37)34-30(25-13-5-3-6-14-25)26-15-7-4-8-16-26/h3-8,12-16,19,22,24,27,30H,9-11,17-18,20-21H2,1-2H3,(H,34,37)/t27-,32?/m1/s1 |
| InChIKey | LXXDCECJZCBKFC-XIDOUCRZSA-N |
| XLogP | 5.90 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|