C26H31N3O3 — CID 70051908
2-[1-amino-1-methyl-6-[4-(piperidin-1-yliminomethyl)benzoyl]-3,4-dihydro-2H-naphthalen-2-yl]acetic acid (PubChem CID 70051908) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[1-amino-1-methyl-6-[4-(piperidin-1-yliminomethyl)benzoyl]-3,4-dihydro-2H-naphthalen-2-yl]acetic acid.
| Compound Name | 2-[1-amino-1-methyl-6-[4-(piperidin-1-yliminomethyl)benzoyl]-3,4-dihydro-2H-naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 70051908 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[1-amino-1-methyl-6-[4-(piperidin-1-yliminomethyl)benzoyl]-3,4-dihydro-2H-naphthalen-2-yl]acetic acid |
| SMILES | CC1(N)c2ccc(C(=O)c3ccc(C=NN4CCCCC4)cc3)cc2CCC1CC(=O)O |
| InChI | InChI=1S/C26H31N3O3/c1-26(27)22(16-24(30)31)11-9-20-15-21(10-12-23(20)26)25(32)19-7-5-18(6-8-19)17-28-29-13-3-2-4-14-29/h5-8,10,12,15,17,22H,2-4,9,11,13-14,16,27H2,1H3,(H,30,31) |
| InChIKey | UQCXPPOCLBPIJB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|