C24H28N4O3S — CID 70055219
methyl 2-[1-amino-7-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetate (PubChem CID 70055219) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is methyl 2-[1-amino-7-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetate.
| Compound Name | methyl 2-[1-amino-7-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 70055219 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | methyl 2-[1-amino-7-[4-(thiomorpholin-4-yliminomethyl)benzoyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
| SMILES | COC(=O)CN1CCc2ccc(C(=O)c3ccc(C=NN4CCSCC4)cc3)cc2C1N |
| InChI | InChI=1S/C24H28N4O3S/c1-31-22(29)16-27-9-8-18-6-7-20(14-21(18)24(27)25)23(30)19-4-2-17(3-5-19)15-26-28-10-12-32-13-11-28/h2-7,14-15,24H,8-13,16,25H2,1H3 |
| InChIKey | MTHWWVHMMFLKCZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|