C29H36N4O5 — CID 70058220
tert-butyl N-[(2S)-2-hydroxy-4-phenylbutyl]-N-[(2-phenylmethoxycarbonylhydrazinyl)-pyridin-2-ylmethyl]carbamate (PubChem CID 70058220) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-hydroxy-4-phenylbutyl]-N-[(2-phenylmethoxycarbonylhydrazinyl)-pyridin-2-ylmethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-hydroxy-4-phenylbutyl]-N-[(2-phenylmethoxycarbonylhydrazinyl)-pyridin-2-ylmethyl]carbamate |
|---|---|
| PubChem CID | 70058220 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | tert-butyl N-[(2S)-2-hydroxy-4-phenylbutyl]-N-[(2-phenylmethoxycarbonylhydrazinyl)-pyridin-2-ylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C[C@@H](O)CCc1ccccc1)C(NNC(=O)OCc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C29H36N4O5/c1-29(2,3)38-28(36)33(20-24(34)18-17-22-12-6-4-7-13-22)26(25-16-10-11-19-30-25)31-32-27(35)37-21-23-14-8-5-9-15-23/h4-16,19,24,26,31,34H,17-18,20-21H2,1-3H3,(H,32,35)/t24-,26?/m0/s1 |
| InChIKey | QQUVZJQYOXQXPR-QSAPEBAKSA-N |
| XLogP | 4.74 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|