C31H39N3O5 — CID 57317800
tert-butyl N-[[(2S)-2-hydroxy-4-phenylbutyl]-(2-phenylethyl)amino]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 57317800) has the molecular formula C31H39N3O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-2-hydroxy-4-phenylbutyl]-(2-phenylethyl)amino]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | tert-butyl N-[[(2S)-2-hydroxy-4-phenylbutyl]-(2-phenylethyl)amino]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 57317800 |
| Molecular Formula | C31H39N3O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | tert-butyl N-[[(2S)-2-hydroxy-4-phenylbutyl]-(2-phenylethyl)amino]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | CC(C)(C)OC(=O)N(NC(=O)OCc1ccccc1)N(CCc1ccccc1)C[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C31H39N3O5/c1-31(2,3)39-30(37)34(32-29(36)38-24-27-17-11-6-12-18-27)33(22-21-26-15-9-5-10-16-26)23-28(35)20-19-25-13-7-4-8-14-25/h4-18,28,35H,19-24H2,1-3H3,(H,32,36)/t28-/m0/s1 |
| InChIKey | ZNBJUDQSJPUVGV-NDEPHWFRSA-N |
| XLogP | 5.52 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|