C30H43N3O5 — CID 57203325
tert-butyl N-[cyclohexylmethyl-[(2S)-2-hydroxy-4-phenylbutyl]amino]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 57203325) has the molecular formula C30H43N3O5 and a molecular weight of 525.69 g/mol. Its IUPAC name is tert-butyl N-[cyclohexylmethyl-[(2S)-2-hydroxy-4-phenylbutyl]amino]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | tert-butyl N-[cyclohexylmethyl-[(2S)-2-hydroxy-4-phenylbutyl]amino]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 57203325 |
| Molecular Formula | C30H43N3O5 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | tert-butyl N-[cyclohexylmethyl-[(2S)-2-hydroxy-4-phenylbutyl]amino]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | CC(C)(C)OC(=O)N(NC(=O)OCc1ccccc1)N(CC1CCCCC1)C[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C30H43N3O5/c1-30(2,3)38-29(36)33(31-28(35)37-23-26-17-11-6-12-18-26)32(21-25-15-9-5-10-16-25)22-27(34)20-19-24-13-7-4-8-14-24/h4,6-8,11-14,17-18,25,27,34H,5,9-10,15-16,19-23H2,1-3H3,(H,31,35)/t27-/m0/s1 |
| InChIKey | AYECFCZEZYKWJE-MHZLTWQESA-N |
| XLogP | 5.86 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|