C32H45N3O4 — CID 67572760
benzyl N-[3-[tert-butyl-(2-hydroxy-4-phenylbutyl)carbamoyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]carbamate (PubChem CID 67572760) has the molecular formula C32H45N3O4 and a molecular weight of 535.73 g/mol. Its IUPAC name is benzyl N-[3-[tert-butyl-(2-hydroxy-4-phenylbutyl)carbamoyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]carbamate.
| Compound Name | benzyl N-[3-[tert-butyl-(2-hydroxy-4-phenylbutyl)carbamoyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 67572760 |
| Molecular Formula | C32H45N3O4 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.34 |
| IUPAC Name | benzyl N-[3-[tert-butyl-(2-hydroxy-4-phenylbutyl)carbamoyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]carbamate |
| SMILES | CC(C)(C)N(CC(O)CCc1ccccc1)C(=O)C1(NC(=O)OCc2ccccc2)CC2CCCCC2CN1 |
| InChI | InChI=1S/C32H45N3O4/c1-31(2,3)35(22-28(36)19-18-24-12-6-4-7-13-24)29(37)32(20-26-16-10-11-17-27(26)21-33-32)34-30(38)39-23-25-14-8-5-9-15-25/h4-9,12-15,26-28,33,36H,10-11,16-23H2,1-3H3,(H,34,38) |
| InChIKey | BDPGNEAKMQCLLN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |