C15H23NSi — CID 70058698
CID 70058698 (PubChem CID 70058698) has the molecular formula C15H23NSi and a molecular weight of 245.44 g/mol.
| Compound Name | CID 70058698 |
|---|---|
| PubChem CID | 70058698 |
| Molecular Formula | C15H23NSi |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C[Si]CN2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C15H23NSi/c1-13-6-7-15(14(2)10-13)11-17-12-16-8-4-3-5-9-16/h6-7,10H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | LZDBHZBESUVKKI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|