C34H30N2O2 — CID 70069464
3-amino-N-(1-hydroxy-3-phenylpropan-2-yl)-N-naphthalen-2-yl-2-[(E)-2-phenylethenyl]benzamide (PubChem CID 70069464) has the molecular formula C34H30N2O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 3-amino-N-(1-hydroxy-3-phenylpropan-2-yl)-N-naphthalen-2-yl-2-[(E)-2-phenylethenyl]benzamide.
| Compound Name | 3-amino-N-(1-hydroxy-3-phenylpropan-2-yl)-N-naphthalen-2-yl-2-[(E)-2-phenylethenyl]benzamide |
|---|---|
| PubChem CID | 70069464 |
| Molecular Formula | C34H30N2O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 3-amino-N-(1-hydroxy-3-phenylpropan-2-yl)-N-naphthalen-2-yl-2-[(E)-2-phenylethenyl]benzamide |
| SMILES | Nc1cccc(C(=O)N(c2ccc3ccccc3c2)C(CO)Cc2ccccc2)c1/C=C/c1ccccc1 |
| InChI | InChI=1S/C34H30N2O2/c35-33-17-9-16-32(31(33)21-18-25-10-3-1-4-11-25)34(38)36(30(24-37)22-26-12-5-2-6-13-26)29-20-19-27-14-7-8-15-28(27)23-29/h1-21,23,30,37H,22,24,35H2/b21-18+ |
| InChIKey | AONAAFCMYOLIMH-DYTRJAOYSA-N |
| XLogP | 6.84 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|