C28H36N4O4 — CID 70072231
butyl 2-[2-amino-6-[4-[(4-methylpiperazin-1-yl)iminomethyl]benzoyl]-3,4-dihydro-2H-chromen-3-yl]acetate (PubChem CID 70072231) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is butyl 2-[2-amino-6-[4-[(4-methylpiperazin-1-yl)iminomethyl]benzoyl]-3,4-dihydro-2H-chromen-3-yl]acetate.
| Compound Name | butyl 2-[2-amino-6-[4-[(4-methylpiperazin-1-yl)iminomethyl]benzoyl]-3,4-dihydro-2H-chromen-3-yl]acetate |
|---|---|
| PubChem CID | 70072231 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | butyl 2-[2-amino-6-[4-[(4-methylpiperazin-1-yl)iminomethyl]benzoyl]-3,4-dihydro-2H-chromen-3-yl]acetate |
| SMILES | CCCCOC(=O)CC1Cc2cc(C(=O)c3ccc(C=NN4CCN(C)CC4)cc3)ccc2OC1N |
| InChI | InChI=1S/C28H36N4O4/c1-3-4-15-35-26(33)18-24-17-23-16-22(9-10-25(23)36-28(24)29)27(34)21-7-5-20(6-8-21)19-30-32-13-11-31(2)12-14-32/h5-10,16,19,24,28H,3-4,11-15,17-18,29H2,1-2H3 |
| InChIKey | KJPIJLVLAMTKLH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|