C14H13N2O3- — CID 7007389
(2R)-2-imidazol-1-yl-4-(4-methylphenyl)-4-oxobutanoate (PubChem CID 7007389) has the molecular formula C14H13N2O3- and a molecular weight of 257.27 g/mol. Its IUPAC name is (2R)-2-imidazol-1-yl-4-(4-methylphenyl)-4-oxobutanoate.
| Compound Name | (2R)-2-imidazol-1-yl-4-(4-methylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7007389 |
| Molecular Formula | C14H13N2O3- |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2R)-2-imidazol-1-yl-4-(4-methylphenyl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)C[C@H](C(=O)[O-])n2ccnc2)cc1 |
| InChI | InChI=1S/C14H14N2O3/c1-10-2-4-11(5-3-10)13(17)8-12(14(18)19)16-7-6-15-9-16/h2-7,9,12H,8H2,1H3,(H,18,19)/p-1/t12-/m1/s1 |
| InChIKey | CCRABWFPDVZZEN-GFCCVEGCSA-M |
| XLogP | 0.76 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |