C20H15ClN2O3S — CID 7007633
N'-[4-(1,3-benzodioxol-5-yl)buta-1,3-dien-2-yl]-3-chloro-1-benzothiophene-2-carbohydrazide (PubChem CID 7007633) has the molecular formula C20H15ClN2O3S and a molecular weight of 398.87 g/mol. Its IUPAC name is N'-[4-(1,3-benzodioxol-5-yl)buta-1,3-dien-2-yl]-3-chloro-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-[4-(1,3-benzodioxol-5-yl)buta-1,3-dien-2-yl]-3-chloro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 7007633 |
| Molecular Formula | C20H15ClN2O3S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N'-[4-(1,3-benzodioxol-5-yl)buta-1,3-dien-2-yl]-3-chloro-1-benzothiophene-2-carbohydrazide |
| SMILES | C=C(C=Cc1ccc2c(c1)OCO2)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H15ClN2O3S/c1-12(6-7-13-8-9-15-16(10-13)26-11-25-15)22-23-20(24)19-18(21)14-4-2-3-5-17(14)27-19/h2-10,22H,1,11H2,(H,23,24) |
| InChIKey | NZKSFSSUYQCWHC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|