C17H24N2O2S — CID 70083463
2-(6-amino-6-methylcyclohexa-2,4-dien-1-yl)-N-butylbenzenesulfonamide (PubChem CID 70083463) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-(6-amino-6-methylcyclohexa-2,4-dien-1-yl)-N-butylbenzenesulfonamide.
| Compound Name | 2-(6-amino-6-methylcyclohexa-2,4-dien-1-yl)-N-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 70083463 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-(6-amino-6-methylcyclohexa-2,4-dien-1-yl)-N-butylbenzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccccc1C1C=CC=CC1(C)N |
| InChI | InChI=1S/C17H24N2O2S/c1-3-4-13-19-22(20,21)16-11-6-5-9-14(16)15-10-7-8-12-17(15,2)18/h5-12,15,19H,3-4,13,18H2,1-2H3 |
| InChIKey | WSLQELXZCCXBCJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|