C29H27Cl2N3O3 — CID 70087838
N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-9,10-dioxoanthracene-2-carboxamide (PubChem CID 70087838) has the molecular formula C29H27Cl2N3O3 and a molecular weight of 536.46 g/mol. Its IUPAC name is N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 70087838 |
| Molecular Formula | C29H27Cl2N3O3 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-9,10-dioxoanthracene-2-carboxamide |
| SMILES | CCCC(NC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O)N1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C29H27Cl2N3O3/c1-2-6-25(34-15-13-33(14-16-34)24-10-5-9-23(30)26(24)31)32-29(37)18-11-12-21-22(17-18)28(36)20-8-4-3-7-19(20)27(21)35/h3-5,7-12,17,25H,2,6,13-16H2,1H3,(H,32,37) |
| InChIKey | GZHOVTNVCJXZMP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|